C17H27IO2 — CID 170742837
[(2E,5E)-2-(2-iodoethylidene)-6,10-dimethylundeca-5,9-dienyl] acetate (PubChem CID 170742837) has the molecular formula C17H27IO2 and a molecular weight of 390.31 g/mol. Its IUPAC name is [(2E,5E)-2-(2-iodoethylidene)-6,10-dimethylundeca-5,9-dienyl] acetate.
| Compound Name | [(2E,5E)-2-(2-iodoethylidene)-6,10-dimethylundeca-5,9-dienyl] acetate |
|---|---|
| PubChem CID | 170742837 |
| Molecular Formula | C17H27IO2 |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [(2E,5E)-2-(2-iodoethylidene)-6,10-dimethylundeca-5,9-dienyl] acetate |
| SMILES | CC(=O)OC/C(=C/CI)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C17H27IO2/c1-14(2)7-5-8-15(3)9-6-10-17(11-12-18)13-20-16(4)19/h7,9,11H,5-6,8,10,12-13H2,1-4H3/b15-9+,17-11+ |
| InChIKey | HOQNJLGJLCHDDF-NZEDCCBKSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|