C15H24O4 — CID 54053147
[2-(2-acetyloxypropylidene)-6-methylhept-5-enyl] acetate (PubChem CID 54053147) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is [2-(2-acetyloxypropylidene)-6-methylhept-5-enyl] acetate.
| Compound Name | [2-(2-acetyloxypropylidene)-6-methylhept-5-enyl] acetate |
|---|---|
| PubChem CID | 54053147 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [2-(2-acetyloxypropylidene)-6-methylhept-5-enyl] acetate |
| SMILES | CC(=O)OCC(=CC(C)OC(C)=O)CCC=C(C)C |
| InChI | InChI=1S/C15H24O4/c1-11(2)7-6-8-15(10-18-13(4)16)9-12(3)19-14(5)17/h7,9,12H,6,8,10H2,1-5H3 |
| InChIKey | LUJCSIAWLLVIFU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|