C17H26O2 — CID 25184885
[(2E)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate (PubChem CID 25184885) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is [(2E)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate.
| Compound Name | [(2E)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate |
|---|---|
| PubChem CID | 25184885 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | [(2E)-6-methylidene-2-(4-methylpent-3-enyl)octa-2,7-dienyl] acetate |
| SMILES | C=CC(=C)CC/C=C(\CCC=C(C)C)COC(C)=O |
| InChI | InChI=1S/C17H26O2/c1-6-15(4)10-8-12-17(13-19-16(5)18)11-7-9-14(2)3/h6,9,12H,1,4,7-8,10-11,13H2,2-3,5H3/b17-12+ |
| InChIKey | GEYNKZNUVHPUPN-SFQUDFHCSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|