C41H60O4 — CID 54253605
7-methyl-3-methylidene-8-[tris(2-methyl-6-methylideneocta-2,7-dienoxy)methoxy]octa-1,6-diene (PubChem CID 54253605) has the molecular formula C41H60O4 and a molecular weight of 616.93 g/mol. Its IUPAC name is 7-methyl-3-methylidene-8-[tris(2-methyl-6-methylideneocta-2,7-dienoxy)methoxy]octa-1,6-diene.
| Compound Name | 7-methyl-3-methylidene-8-[tris(2-methyl-6-methylideneocta-2,7-dienoxy)methoxy]octa-1,6-diene |
|---|---|
| PubChem CID | 54253605 |
| Molecular Formula | C41H60O4 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.45 |
| IUPAC Name | 7-methyl-3-methylidene-8-[tris(2-methyl-6-methylideneocta-2,7-dienoxy)methoxy]octa-1,6-diene |
| SMILES | C=CC(=C)CCC=C(C)COC(OCC(C)=CCCC(=C)C=C)(OCC(C)=CCCC(=C)C=C)OCC(C)=CCCC(=C)C=C |
| InChI | InChI=1S/C41H60O4/c1-13-33(5)21-17-25-37(9)29-42-41(43-30-38(10)26-18-22-34(6)14-2,44-31-39(11)27-19-23-35(7)15-3)45-32-40(12)28-20-24-36(8)16-4/h13-16,25-28H,1-8,17-24,29-32H2,9-12H3 |
| InChIKey | QYMCCFFBTRTZBQ-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|