C15H26N2 — CID 146877130
1-methyl-4-[(2Z)-2-methyl-6-methylideneocta-2,7-dienyl]piperazine (PubChem CID 146877130) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-methyl-4-[(2Z)-2-methyl-6-methylideneocta-2,7-dienyl]piperazine.
| Compound Name | 1-methyl-4-[(2Z)-2-methyl-6-methylideneocta-2,7-dienyl]piperazine |
|---|---|
| PubChem CID | 146877130 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-methyl-4-[(2Z)-2-methyl-6-methylideneocta-2,7-dienyl]piperazine |
| SMILES | C=CC(=C)CC/C=C(/C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C15H26N2/c1-5-14(2)7-6-8-15(3)13-17-11-9-16(4)10-12-17/h5,8H,1-2,6-7,9-13H2,3-4H3/b15-8- |
| InChIKey | SQSWBYOPYQCEOL-NVNXTCNLSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|