C19H36N2 — CID 155617676
1-[(2E,6Z)-2,6-dimethyldodeca-2,6-dienyl]-4-methylpiperazine (PubChem CID 155617676) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 1-[(2E,6Z)-2,6-dimethyldodeca-2,6-dienyl]-4-methylpiperazine.
| Compound Name | 1-[(2E,6Z)-2,6-dimethyldodeca-2,6-dienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 155617676 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 1-[(2E,6Z)-2,6-dimethyldodeca-2,6-dienyl]-4-methylpiperazine |
| SMILES | CCCCC/C=C(/C)CC/C=C(\C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C19H36N2/c1-5-6-7-8-10-18(2)11-9-12-19(3)17-21-15-13-20(4)14-16-21/h10,12H,5-9,11,13-17H2,1-4H3/b18-10-,19-12+ |
| InChIKey | ZHDGFQNQVQETHM-LLVOSQLVSA-N |
| XLogP | 4.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|