C35H63IN4 — CID 170054378
1-[(2Z,6E,9E,13Z)-6-hexylidene-10-(iodomethyl)-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methyl-1,4-diazepane (PubChem CID 170054378) has the molecular formula C35H63IN4 and a molecular weight of 666.82 g/mol. Its IUPAC name is 1-[(2Z,6E,9E,13Z)-6-hexylidene-10-(iodomethyl)-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methyl-1,4-diazepane.
| Compound Name | 1-[(2Z,6E,9E,13Z)-6-hexylidene-10-(iodomethyl)-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 170054378 |
| Molecular Formula | C35H63IN4 |
| Molecular Weight | 666.82 g/mol |
| Exact Mass | 666.41 |
| IUPAC Name | 1-[(2Z,6E,9E,13Z)-6-hexylidene-10-(iodomethyl)-2,14-dimethyl-15-(4-methylpiperazin-1-yl)pentadeca-2,9,13-trienyl]-4-methyl-1,4-diazepane |
| SMILES | CCCCC/C=C(\CC/C=C(/C)CN1CCCN(C)CC1)CC/C=C(/CI)CC/C=C(/C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C35H63IN4/c1-6-7-8-9-16-34(17-10-14-32(2)30-39-22-13-21-37(4)23-26-39)18-12-20-35(29-36)19-11-15-33(3)31-40-27-24-38(5)25-28-40/h14-16,20H,6-13,17-19,21-31H2,1-5H3/b32-14-,33-15-,34-16+,35-20+ |
| InChIKey | MCVONCUDEDVJDY-OQWHNZQPSA-N |
| XLogP | 7.97 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.82 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|