C18H32LiNO — CID 156682915
lithium 4-[(2Z,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]morpholine (PubChem CID 156682915) has the molecular formula C18H32LiNO and a molecular weight of 285.40 g/mol. Its IUPAC name is lithium 4-[(2Z,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]morpholine.
| Compound Name | lithium 4-[(2Z,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]morpholine |
|---|---|
| PubChem CID | 156682915 |
| Molecular Formula | C18H32LiNO |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.26 |
| IUPAC Name | lithium 4-[(2Z,6Z)-6-methanidyl-2-methyldodeca-2,6-dienyl]morpholine |
| SMILES | [CH2-]/C(=C/CCCCC)CC/C=C(/C)CN1CCOCC1.[Li+] |
| InChI | InChI=1S/C18H32NO.Li/c1-4-5-6-7-9-17(2)10-8-11-18(3)16-19-12-14-20-15-13-19;/h9,11H,2,4-8,10,12-16H2,1,3H3;/q-1;+1/b17-9-,18-11-; |
| InChIKey | RALAENIPDMRBLK-AXJLBUQOSA-N |
| XLogP | 1.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|