C14H25NO2 — CID 54272275
3,7-dimethyl-8-morpholin-4-ylocta-2,6-dien-1-ol (PubChem CID 54272275) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 3,7-dimethyl-8-morpholin-4-ylocta-2,6-dien-1-ol.
| Compound Name | 3,7-dimethyl-8-morpholin-4-ylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 54272275 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 3,7-dimethyl-8-morpholin-4-ylocta-2,6-dien-1-ol |
| SMILES | CC(=CCO)CCC=C(C)CN1CCOCC1 |
| InChI | InChI=1S/C14H25NO2/c1-13(6-9-16)4-3-5-14(2)12-15-7-10-17-11-8-15/h5-6,16H,3-4,7-12H2,1-2H3 |
| InChIKey | RKZIHYPNQXNGKP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|