C18H32ClNO — CID 154986326
4-[(2Z,6E)-6-(chloromethyl)-2-methyldodeca-2,6-dienyl]morpholine (PubChem CID 154986326) has the molecular formula C18H32ClNO and a molecular weight of 313.91 g/mol. Its IUPAC name is 4-[(2Z,6E)-6-(chloromethyl)-2-methyldodeca-2,6-dienyl]morpholine.
| Compound Name | 4-[(2Z,6E)-6-(chloromethyl)-2-methyldodeca-2,6-dienyl]morpholine |
|---|---|
| PubChem CID | 154986326 |
| Molecular Formula | C18H32ClNO |
| Molecular Weight | 313.91 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 4-[(2Z,6E)-6-(chloromethyl)-2-methyldodeca-2,6-dienyl]morpholine |
| SMILES | CCCCC/C=C(/CCl)CC/C=C(/C)CN1CCOCC1 |
| InChI | InChI=1S/C18H32ClNO/c1-3-4-5-6-9-18(15-19)10-7-8-17(2)16-20-11-13-21-14-12-20/h8-9H,3-7,10-16H2,1-2H3/b17-8-,18-9+ |
| InChIKey | ODMHJLLOIYGQBJ-IADIARBNSA-N |
| XLogP | 4.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.91 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|