C19H31NO2 — CID 6320518
3,7,11-trimethyl-1-morpholin-4-yldodeca-2,6,10-trien-1-one (PubChem CID 6320518) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 3,7,11-trimethyl-1-morpholin-4-yldodeca-2,6,10-trien-1-one.
| Compound Name | 3,7,11-trimethyl-1-morpholin-4-yldodeca-2,6,10-trien-1-one |
|---|---|
| PubChem CID | 6320518 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 3,7,11-trimethyl-1-morpholin-4-yldodeca-2,6,10-trien-1-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H31NO2/c1-16(2)7-5-8-17(3)9-6-10-18(4)15-19(21)20-11-13-22-14-12-20/h7,9,15H,5-6,8,10-14H2,1-4H3 |
| InChIKey | IVAXYKPQCGJMHY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|