C30H49NO2 — CID 70401551
(2E,6E,10E,14E)-1-(3-hydroxypiperidin-1-yl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-one (PubChem CID 70401551) has the molecular formula C30H49NO2 and a molecular weight of 455.73 g/mol. Its IUPAC name is (2E,6E,10E,14E)-1-(3-hydroxypiperidin-1-yl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-one.
| Compound Name | (2E,6E,10E,14E)-1-(3-hydroxypiperidin-1-yl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-one |
|---|---|
| PubChem CID | 70401551 |
| Molecular Formula | C30H49NO2 |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 455.38 |
| IUPAC Name | (2E,6E,10E,14E)-1-(3-hydroxypiperidin-1-yl)-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaen-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C30H49NO2/c1-24(2)12-7-13-25(3)14-8-15-26(4)16-9-17-27(5)18-10-19-28(6)22-30(33)31-21-11-20-29(32)23-31/h12,14,16,18,22,29,32H,7-11,13,15,17,19-21,23H2,1-6H3/b25-14+,26-16+,27-18+,28-22+ |
| InChIKey | YBGQWQWKTIFHCU-WGMFPTMNSA-N |
| XLogP | 7.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|