C29H50N2O — CID 21297965
(2E,6E,10E)-1-[3-(diethylamino)piperidin-1-yl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one (PubChem CID 21297965) has the molecular formula C29H50N2O and a molecular weight of 442.73 g/mol. Its IUPAC name is (2E,6E,10E)-1-[3-(diethylamino)piperidin-1-yl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one.
| Compound Name | (2E,6E,10E)-1-[3-(diethylamino)piperidin-1-yl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one |
|---|---|
| PubChem CID | 21297965 |
| Molecular Formula | C29H50N2O |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.39 |
| IUPAC Name | (2E,6E,10E)-1-[3-(diethylamino)piperidin-1-yl]-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one |
| SMILES | CCN(CC)C1CCCN(C(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1 |
| InChI | InChI=1S/C29H50N2O/c1-8-30(9-2)28-20-13-21-31(23-28)29(32)22-27(7)19-12-18-26(6)17-11-16-25(5)15-10-14-24(3)4/h14,16,18,22,28H,8-13,15,17,19-21,23H2,1-7H3/b25-16+,26-18+,27-22+ |
| InChIKey | ZEWBQFONRSILSV-UYWSHKLTSA-N |
| XLogP | 7.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|