C22H38N2O — CID 54177070
1-[3-(dimethylamino)piperidin-1-yl]-3,7,11-trimethyldodeca-2,6,10-trien-1-one (PubChem CID 54177070) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is 1-[3-(dimethylamino)piperidin-1-yl]-3,7,11-trimethyldodeca-2,6,10-trien-1-one.
| Compound Name | 1-[3-(dimethylamino)piperidin-1-yl]-3,7,11-trimethyldodeca-2,6,10-trien-1-one |
|---|---|
| PubChem CID | 54177070 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 1-[3-(dimethylamino)piperidin-1-yl]-3,7,11-trimethyldodeca-2,6,10-trien-1-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(=O)N1CCCC(N(C)C)C1 |
| InChI | InChI=1S/C22H38N2O/c1-18(2)10-7-11-19(3)12-8-13-20(4)16-22(25)24-15-9-14-21(17-24)23(5)6/h10,12,16,21H,7-9,11,13-15,17H2,1-6H3 |
| InChIKey | OZDDMGCQTDINJX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|