C27H52N2O — CID 54085113
1-[3-(dimethylamino)piperidin-1-yl]-3,7,11,15-tetramethylhexadec-2-en-1-one (PubChem CID 54085113) has the molecular formula C27H52N2O and a molecular weight of 420.73 g/mol. Its IUPAC name is 1-[3-(dimethylamino)piperidin-1-yl]-3,7,11,15-tetramethylhexadec-2-en-1-one.
| Compound Name | 1-[3-(dimethylamino)piperidin-1-yl]-3,7,11,15-tetramethylhexadec-2-en-1-one |
|---|---|
| PubChem CID | 54085113 |
| Molecular Formula | C27H52N2O |
| Molecular Weight | 420.73 g/mol |
| Exact Mass | 420.41 |
| IUPAC Name | 1-[3-(dimethylamino)piperidin-1-yl]-3,7,11,15-tetramethylhexadec-2-en-1-one |
| SMILES | CC(=CC(=O)N1CCCC(N(C)C)C1)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C27H52N2O/c1-22(2)12-8-13-23(3)14-9-15-24(4)16-10-17-25(5)20-27(30)29-19-11-18-26(21-29)28(6)7/h20,22-24,26H,8-19,21H2,1-7H3 |
| InChIKey | MPXDWGTZQMMBPI-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.73 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|