C26H49NO — CID 21297947
(E)-3,7,11,15-tetramethyl-1-(4-methylpiperidin-1-yl)hexadec-2-en-1-one (PubChem CID 21297947) has the molecular formula C26H49NO and a molecular weight of 391.68 g/mol. Its IUPAC name is (E)-3,7,11,15-tetramethyl-1-(4-methylpiperidin-1-yl)hexadec-2-en-1-one.
| Compound Name | (E)-3,7,11,15-tetramethyl-1-(4-methylpiperidin-1-yl)hexadec-2-en-1-one |
|---|---|
| PubChem CID | 21297947 |
| Molecular Formula | C26H49NO |
| Molecular Weight | 391.68 g/mol |
| Exact Mass | 391.38 |
| IUPAC Name | (E)-3,7,11,15-tetramethyl-1-(4-methylpiperidin-1-yl)hexadec-2-en-1-one |
| SMILES | C/C(=C\C(=O)N1CCC(C)CC1)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C26H49NO/c1-21(2)10-7-11-22(3)12-8-13-23(4)14-9-15-25(6)20-26(28)27-18-16-24(5)17-19-27/h20-24H,7-19H2,1-6H3/b25-20+ |
| InChIKey | SEVNNAOQEWBUGB-LKUDQCMESA-N |
| XLogP | 7.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.68 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|