C26H44ClN2O+ — CID 70401946
1-(2-chloro-4,4-dimethylpiperazin-4-ium-1-yl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one (PubChem CID 70401946) has the molecular formula C26H44ClN2O+ and a molecular weight of 436.10 g/mol. Its IUPAC name is 1-(2-chloro-4,4-dimethylpiperazin-4-ium-1-yl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one.
| Compound Name | 1-(2-chloro-4,4-dimethylpiperazin-4-ium-1-yl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one |
|---|---|
| PubChem CID | 70401946 |
| Molecular Formula | C26H44ClN2O+ |
| Molecular Weight | 436.10 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 1-(2-chloro-4,4-dimethylpiperazin-4-ium-1-yl)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC(=O)N1CC[N+](C)(C)CC1Cl |
| InChI | InChI=1S/C26H44ClN2O/c1-21(2)11-8-12-22(3)13-9-14-23(4)15-10-16-24(5)19-26(30)28-17-18-29(6,7)20-25(28)27/h11,13,15,19,25H,8-10,12,14,16-18,20H2,1-7H3/q+1 |
| InChIKey | OWEHMWMZEZXVNZ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.10 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|