C12H20N2 — CID 143176220
1-methyl-4-[(3Z)-2-methylidenehexa-3,5-dienyl]piperazine (PubChem CID 143176220) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-methyl-4-[(3Z)-2-methylidenehexa-3,5-dienyl]piperazine.
| Compound Name | 1-methyl-4-[(3Z)-2-methylidenehexa-3,5-dienyl]piperazine |
|---|---|
| PubChem CID | 143176220 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-methyl-4-[(3Z)-2-methylidenehexa-3,5-dienyl]piperazine |
| SMILES | C=C/C=C\C(=C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C12H20N2/c1-4-5-6-12(2)11-14-9-7-13(3)8-10-14/h4-6H,1-2,7-11H2,3H3/b6-5- |
| InChIKey | LSZGRLCWYOTVDK-WAYWQWQTSA-N |
| XLogP | 1.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|