C11H20N2O — CID 91548753
1-(2-buta-1,3-dienoxyethyl)-4-methylpiperazine (PubChem CID 91548753) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-(2-buta-1,3-dienoxyethyl)-4-methylpiperazine.
| Compound Name | 1-(2-buta-1,3-dienoxyethyl)-4-methylpiperazine |
|---|---|
| PubChem CID | 91548753 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 1-(2-buta-1,3-dienoxyethyl)-4-methylpiperazine |
| SMILES | C=CC=COCCN1CCN(C)CC1 |
| InChI | InChI=1S/C11H20N2O/c1-3-4-10-14-11-9-13-7-5-12(2)6-8-13/h3-4,10H,1,5-9,11H2,2H3 |
| InChIKey | SFMDLFFAMFCXPP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|