C12H22N2O2 — CID 71333748
1,4-bis(2-ethenoxyethyl)piperazine (PubChem CID 71333748) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1,4-bis(2-ethenoxyethyl)piperazine.
| Compound Name | 1,4-bis(2-ethenoxyethyl)piperazine |
|---|---|
| PubChem CID | 71333748 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1,4-bis(2-ethenoxyethyl)piperazine |
| SMILES | C=COCCN1CCN(CCOC=C)CC1 |
| InChI | InChI=1S/C12H22N2O2/c1-3-15-11-9-13-5-7-14(8-6-13)10-12-16-4-2/h3-4H,1-2,5-12H2 |
| InChIKey | UIQWIFBRBUYDRI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|