C13H20Cl2N2 — CID 144697900
1-[(4E)-5,6-dichloro-3-methylidenehepta-4,6-dienyl]-4-methylpiperazine (PubChem CID 144697900) has the molecular formula C13H20Cl2N2 and a molecular weight of 275.22 g/mol. Its IUPAC name is 1-[(4E)-5,6-dichloro-3-methylidenehepta-4,6-dienyl]-4-methylpiperazine.
| Compound Name | 1-[(4E)-5,6-dichloro-3-methylidenehepta-4,6-dienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 144697900 |
| Molecular Formula | C13H20Cl2N2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-[(4E)-5,6-dichloro-3-methylidenehepta-4,6-dienyl]-4-methylpiperazine |
| SMILES | C=C(/C=C(/Cl)C(=C)Cl)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C13H20Cl2N2/c1-11(10-13(15)12(2)14)4-5-17-8-6-16(3)7-9-17/h10H,1-2,4-9H2,3H3/b13-10+ |
| InChIKey | GOQJWFUEOQEIDE-JLHYYAGUSA-N |
| XLogP | 3.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|