C14H22N2O — CID 143710844
(3E,5E)-6-[(4-methylpiperazin-1-yl)methyl]octa-3,5,7-trien-2-one (PubChem CID 143710844) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (3E,5E)-6-[(4-methylpiperazin-1-yl)methyl]octa-3,5,7-trien-2-one.
| Compound Name | (3E,5E)-6-[(4-methylpiperazin-1-yl)methyl]octa-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 143710844 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (3E,5E)-6-[(4-methylpiperazin-1-yl)methyl]octa-3,5,7-trien-2-one |
| SMILES | C=C/C(=C\C=C\C(C)=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C14H22N2O/c1-4-14(7-5-6-13(2)17)12-16-10-8-15(3)9-11-16/h4-7H,1,8-12H2,2-3H3/b6-5+,14-7+ |
| InChIKey | UOBZSAZPVCVEEZ-AVJLEEFCSA-N |
| XLogP | 1.49 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|