C13H24N2 — CID 123462135
1-(2-ethylidenepent-3-enyl)-4-methyl-1,4-diazepane (PubChem CID 123462135) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-(2-ethylidenepent-3-enyl)-4-methyl-1,4-diazepane.
| Compound Name | 1-(2-ethylidenepent-3-enyl)-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 123462135 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-(2-ethylidenepent-3-enyl)-4-methyl-1,4-diazepane |
| SMILES | CC=CC(=CC)CN1CCCN(C)CC1 |
| InChI | InChI=1S/C13H24N2/c1-4-7-13(5-2)12-15-9-6-8-14(3)10-11-15/h4-5,7H,6,8-12H2,1-3H3 |
| InChIKey | UGRCUJBAIAMHNO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|