C14H26N2 — CID 134365028
1-ethyl-4-[(Z,2E)-2-ethylidenepent-3-enyl]-1,4-diazepane (PubChem CID 134365028) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-ethyl-4-[(Z,2E)-2-ethylidenepent-3-enyl]-1,4-diazepane.
| Compound Name | 1-ethyl-4-[(Z,2E)-2-ethylidenepent-3-enyl]-1,4-diazepane |
|---|---|
| PubChem CID | 134365028 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-ethyl-4-[(Z,2E)-2-ethylidenepent-3-enyl]-1,4-diazepane |
| SMILES | C/C=C\C(=C/C)CN1CCCN(CC)CC1 |
| InChI | InChI=1S/C14H26N2/c1-4-8-14(5-2)13-16-10-7-9-15(6-3)11-12-16/h4-5,8H,6-7,9-13H2,1-3H3/b8-4-,14-5+ |
| InChIKey | QHMKUVVGPOFFJJ-NYQUBNGWSA-N |
| XLogP | 2.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|