C10H20N2O — CID 89081102
1-(5-ethyl-1,5-diazocan-1-yl)ethanone (PubChem CID 89081102) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(5-ethyl-1,5-diazocan-1-yl)ethanone.
| Compound Name | 1-(5-ethyl-1,5-diazocan-1-yl)ethanone |
|---|---|
| PubChem CID | 89081102 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-(5-ethyl-1,5-diazocan-1-yl)ethanone |
| SMILES | CCN1CCCN(C(C)=O)CCC1 |
| InChI | InChI=1S/C10H20N2O/c1-3-11-6-4-8-12(10(2)13)9-5-7-11/h3-9H2,1-2H3 |
| InChIKey | CBIUCNVOVRNNQK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |