C10H17ClN2O — CID 131059736
2-chloro-1-(4-ethyl-1,4-diazepan-1-yl)prop-2-en-1-one (PubChem CID 131059736) has the molecular formula C10H17ClN2O and a molecular weight of 216.71 g/mol. Its IUPAC name is 2-chloro-1-(4-ethyl-1,4-diazepan-1-yl)prop-2-en-1-one.
| Compound Name | 2-chloro-1-(4-ethyl-1,4-diazepan-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 131059736 |
| Molecular Formula | C10H17ClN2O |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-chloro-1-(4-ethyl-1,4-diazepan-1-yl)prop-2-en-1-one |
| SMILES | C=C(Cl)C(=O)N1CCCN(CC)CC1 |
| InChI | InChI=1S/C10H17ClN2O/c1-3-12-5-4-6-13(8-7-12)10(14)9(2)11/h2-8H2,1H3 |
| InChIKey | FPHNRPMJTBHTII-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|