C9H16N2O3 — CID 167020514
1-(4-ethylpiperazin-1-yl)-3-hydroxypropane-1,2-dione (PubChem CID 167020514) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-3-hydroxypropane-1,2-dione.
| Compound Name | 1-(4-ethylpiperazin-1-yl)-3-hydroxypropane-1,2-dione |
|---|---|
| PubChem CID | 167020514 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-3-hydroxypropane-1,2-dione |
| SMILES | CCN1CCN(C(=O)C(=O)CO)CC1 |
| InChI | InChI=1S/C9H16N2O3/c1-2-10-3-5-11(6-4-10)9(14)8(13)7-12/h12H,2-7H2,1H3 |
| InChIKey | BOZXZHGZDOCYQF-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|