C14H26N2O — CID 104749970
1-cyclohexyl-2-(4-methyl-1,4-diazepan-1-yl)ethanone (PubChem CID 104749970) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 1-cyclohexyl-2-(4-methyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 1-cyclohexyl-2-(4-methyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 104749970 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-cyclohexyl-2-(4-methyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CN1CCCN(CC(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C14H26N2O/c1-15-8-5-9-16(11-10-15)12-14(17)13-6-3-2-4-7-13/h13H,2-12H2,1H3 |
| InChIKey | BWJXOCWODFVSMO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |