About ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine
ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine (PubChem CID 166529175) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine.
Molecular Properties
| Compound Name | ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine |
| PubChem CID | 166529175 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine |
| SMILES | C=C/C(=C\C=C/C)CN1CCCCC1.CC |
| InChI | InChI=1S/C13H21N.C2H6/c1-3-5-9-13(4-2)12-14-10-7-6-8-11-14;1-2/h3-5,9H,2,6-8,10-12H2,1H3;1-2H3/b5-3-,13-9+; |
| InChIKey | MPIPSERGTLTCQF-SHNMFRIGSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine?
The IUPAC name of ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine (CID 166529175) is ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine.
What is the SMILES notation for ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine?
The canonical SMILES for ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine is C=C/C(=C\C=C/C)CN1CCCCC1.CC.
What is the InChIKey of ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine?
The InChIKey is MPIPSERGTLTCQF-SHNMFRIGSA-N. The full InChI is InChI=1S/C13H21N.C2H6/c1-3-5-9-13(4-2)12-14-10-7-6-8-11-14;1-2/h3-5,9H,2,6-8,10-12H2,1H3;1-2H3/b5-3-,13-9+;.
What are the key properties of ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine?
ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine has a molecular weight of 221.39 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine is sourced from PubChem (CID 166529175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).