C15H27N — CID 166529175
ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine (PubChem CID 166529175) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine.
| Compound Name | ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine |
|---|---|
| PubChem CID | 166529175 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;1-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]piperidine |
| SMILES | C=C/C(=C\C=C/C)CN1CCCCC1.CC |
| InChI | InChI=1S/C13H21N.C2H6/c1-3-5-9-13(4-2)12-14-10-7-6-8-11-14;1-2/h3-5,9H,2,6-8,10-12H2,1H3;1-2H3/b5-3-,13-9+; |
| InChIKey | MPIPSERGTLTCQF-SHNMFRIGSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|