C26H50N2 — CID 145196085
ethane;1-[5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]cyclooctyl]-4-propylpiperazine (PubChem CID 145196085) has the molecular formula C26H50N2 and a molecular weight of 390.70 g/mol. Its IUPAC name is ethane;1-[5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]cyclooctyl]-4-propylpiperazine.
| Compound Name | ethane;1-[5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]cyclooctyl]-4-propylpiperazine |
|---|---|
| PubChem CID | 145196085 |
| Molecular Formula | C26H50N2 |
| Molecular Weight | 390.70 g/mol |
| Exact Mass | 390.40 |
| IUPAC Name | ethane;1-[5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]cyclooctyl]-4-propylpiperazine |
| SMILES | C=C/C(=C\C=C/C)C1CCCC(N2CCN(CCC)CC2)CCC1.CC.CC |
| InChI | InChI=1S/C22H38N2.2C2H6/c1-4-7-10-20(6-3)21-11-8-13-22(14-9-12-21)24-18-16-23(15-5-2)17-19-24;2*1-2/h4,6-7,10,21-22H,3,5,8-9,11-19H2,1-2H3;2*1-2H3/b7-4-,20-10+;; |
| InChIKey | LVRJQJSXSFBFKN-XLHFFOJGSA-N |
| XLogP | 7.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.70 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|