C23H41FN2 — CID 174279346
2-N-[2-[(4Z)-8-fluoro-3-methyl-2-(2-methylpropyl)cyclonona-2,4,8-trien-1-yl]ethyl]-1-N,1-N,2-N-trimethylbutane-1,2-diamine (PubChem CID 174279346) has the molecular formula C23H41FN2 and a molecular weight of 364.59 g/mol. Its IUPAC name is 2-N-[2-[(4Z)-8-fluoro-3-methyl-2-(2-methylpropyl)cyclonona-2,4,8-trien-1-yl]ethyl]-1-N,1-N,2-N-trimethylbutane-1,2-diamine.
| Compound Name | 2-N-[2-[(4Z)-8-fluoro-3-methyl-2-(2-methylpropyl)cyclonona-2,4,8-trien-1-yl]ethyl]-1-N,1-N,2-N-trimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 174279346 |
| Molecular Formula | C23H41FN2 |
| Molecular Weight | 364.59 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | 2-N-[2-[(4Z)-8-fluoro-3-methyl-2-(2-methylpropyl)cyclonona-2,4,8-trien-1-yl]ethyl]-1-N,1-N,2-N-trimethylbutane-1,2-diamine |
| SMILES | CCC(CN(C)C)N(C)CCC1C=C(F)CC/C=C\C(C)=C1CC(C)C |
| InChI | InChI=1S/C23H41FN2/c1-8-22(17-25(5)6)26(7)14-13-20-16-21(24)12-10-9-11-19(4)23(20)15-18(2)3/h9,11,16,18,20,22H,8,10,12-15,17H2,1-7H3/b11-9-,21-16?,23-19? |
| InChIKey | UWJQQGQAWOBNJI-KRCRFCQQSA-N |
| XLogP | 5.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |