C24H41F3N2 — CID 143036773
1-N,2-N,2-N-trimethyl-1-N-[(3E,5Z)-3-methyl-2-(1-methylcyclohexyl)-7-(trifluoromethyl)octa-3,5,7-trienyl]butane-1,2-diamine (PubChem CID 143036773) has the molecular formula C24H41F3N2 and a molecular weight of 414.60 g/mol. Its IUPAC name is 1-N,2-N,2-N-trimethyl-1-N-[(3E,5Z)-3-methyl-2-(1-methylcyclohexyl)-7-(trifluoromethyl)octa-3,5,7-trienyl]butane-1,2-diamine.
| Compound Name | 1-N,2-N,2-N-trimethyl-1-N-[(3E,5Z)-3-methyl-2-(1-methylcyclohexyl)-7-(trifluoromethyl)octa-3,5,7-trienyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 143036773 |
| Molecular Formula | C24H41F3N2 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | 1-N,2-N,2-N-trimethyl-1-N-[(3E,5Z)-3-methyl-2-(1-methylcyclohexyl)-7-(trifluoromethyl)octa-3,5,7-trienyl]butane-1,2-diamine |
| SMILES | C=C(/C=C\C=C(/C)C(CN(C)CC(CC)N(C)C)C1(C)CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C24H41F3N2/c1-8-21(28(5)6)17-29(7)18-22(23(4)15-10-9-11-16-23)19(2)13-12-14-20(3)24(25,26)27/h12-14,21-22H,3,8-11,15-18H2,1-2,4-7H3/b14-12-,19-13+ |
| InChIKey | OCWDTUODRBWDNN-WROMKANLSA-N |
| XLogP | 6.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|