C20H39N — CID 123746640
N,N,4-trimethyl-10-propyltetradeca-10,12-dien-6-amine (PubChem CID 123746640) has the molecular formula C20H39N and a molecular weight of 293.54 g/mol. Its IUPAC name is N,N,4-trimethyl-10-propyltetradeca-10,12-dien-6-amine.
| Compound Name | N,N,4-trimethyl-10-propyltetradeca-10,12-dien-6-amine |
|---|---|
| PubChem CID | 123746640 |
| Molecular Formula | C20H39N |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 293.31 |
| IUPAC Name | N,N,4-trimethyl-10-propyltetradeca-10,12-dien-6-amine |
| SMILES | CC=CC=C(CCC)CCCC(CC(C)CCC)N(C)C |
| InChI | InChI=1S/C20H39N/c1-7-10-14-19(13-9-3)15-11-16-20(21(5)6)17-18(4)12-8-2/h7,10,14,18,20H,8-9,11-13,15-17H2,1-6H3 |
| InChIKey | YLQHSVXLORVPSZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|