C26H41F2N — CID 91475343
N-(7-cyclobutyl-3-ethenyl-1,1-difluoronona-4,6-dien-2-yl)-N,5-diethylcyclohept-3-en-1-amine (PubChem CID 91475343) has the molecular formula C26H41F2N and a molecular weight of 405.62 g/mol. Its IUPAC name is N-(7-cyclobutyl-3-ethenyl-1,1-difluoronona-4,6-dien-2-yl)-N,5-diethylcyclohept-3-en-1-amine.
| Compound Name | N-(7-cyclobutyl-3-ethenyl-1,1-difluoronona-4,6-dien-2-yl)-N,5-diethylcyclohept-3-en-1-amine |
|---|---|
| PubChem CID | 91475343 |
| Molecular Formula | C26H41F2N |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | N-(7-cyclobutyl-3-ethenyl-1,1-difluoronona-4,6-dien-2-yl)-N,5-diethylcyclohept-3-en-1-amine |
| SMILES | C=CC(C=CC=C(CC)C1CCC1)C(C(F)F)N(CC)C1CC=CC(CC)CC1 |
| InChI | InChI=1S/C26H41F2N/c1-5-20-12-9-17-24(19-18-20)29(8-4)25(26(27)28)22(7-3)14-10-13-21(6-2)23-15-11-16-23/h7,9-10,12-14,20,22-26H,3,5-6,8,11,15-19H2,1-2,4H3 |
| InChIKey | PSCZEHNWDVMSTI-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|