C30H53N — CID 139353167
(9E,11Z,13E)-6-ethenyl-N-ethyl-9,10-dimethyl-N-(2-methylheptan-4-yl)-3-methylidenepentadeca-9,11,13-trien-1-amine (PubChem CID 139353167) has the molecular formula C30H53N and a molecular weight of 427.76 g/mol. Its IUPAC name is (9E,11Z,13E)-6-ethenyl-N-ethyl-9,10-dimethyl-N-(2-methylheptan-4-yl)-3-methylidenepentadeca-9,11,13-trien-1-amine.
| Compound Name | (9E,11Z,13E)-6-ethenyl-N-ethyl-9,10-dimethyl-N-(2-methylheptan-4-yl)-3-methylidenepentadeca-9,11,13-trien-1-amine |
|---|---|
| PubChem CID | 139353167 |
| Molecular Formula | C30H53N |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 427.42 |
| IUPAC Name | (9E,11Z,13E)-6-ethenyl-N-ethyl-9,10-dimethyl-N-(2-methylheptan-4-yl)-3-methylidenepentadeca-9,11,13-trien-1-amine |
| SMILES | C=CC(CCC(=C)CCN(CC)C(CCC)CC(C)C)CC/C(C)=C(C)/C=C\C=C\C |
| InChI | InChI=1S/C30H53N/c1-10-14-15-17-27(8)28(9)19-21-29(12-3)20-18-26(7)22-23-31(13-4)30(16-11-2)24-25(5)6/h10,12,14-15,17,25,29-30H,3,7,11,13,16,18-24H2,1-2,4-6,8-9H3/b14-10+,17-15-,28-27+ |
| InChIKey | JNGFDZYSXUPUNU-WLWDOUNWSA-N |
| XLogP | 9.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|