C19H39N — CID 143670584
ethane;(2Z,4Z,6E)-octa-2,4,6-triene;N,N,5-trimethylhexan-3-amine (PubChem CID 143670584) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is ethane;(2Z,4Z,6E)-octa-2,4,6-triene;N,N,5-trimethylhexan-3-amine.
| Compound Name | ethane;(2Z,4Z,6E)-octa-2,4,6-triene;N,N,5-trimethylhexan-3-amine |
|---|---|
| PubChem CID | 143670584 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | ethane;(2Z,4Z,6E)-octa-2,4,6-triene;N,N,5-trimethylhexan-3-amine |
| SMILES | C/C=C\C=C/C=C/C.CC.CCC(CC(C)C)N(C)C |
| InChI | InChI=1S/C9H21N.C8H12.C2H6/c1-6-9(10(4)5)7-8(2)3;1-3-5-7-8-6-4-2;1-2/h8-9H,6-7H2,1-5H3;3-8H,1-2H3;1-2H3/b;5-3-,6-4+,8-7-; |
| InChIKey | SIBHTXUSKCVWMH-MAXYKHLGSA-N |
| XLogP | 6.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|