C17H31N — CID 170706540
(2E,4Z)-N-hexan-3-yl-N,2,3,6-tetramethylhepta-2,4,6-trien-1-amine (PubChem CID 170706540) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is (2E,4Z)-N-hexan-3-yl-N,2,3,6-tetramethylhepta-2,4,6-trien-1-amine.
| Compound Name | (2E,4Z)-N-hexan-3-yl-N,2,3,6-tetramethylhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 170706540 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | (2E,4Z)-N-hexan-3-yl-N,2,3,6-tetramethylhepta-2,4,6-trien-1-amine |
| SMILES | C=C(C)/C=C\C(C)=C(/C)CN(C)C(CC)CCC |
| InChI | InChI=1S/C17H31N/c1-8-10-17(9-2)18(7)13-16(6)15(5)12-11-14(3)4/h11-12,17H,3,8-10,13H2,1-2,4-7H3/b12-11-,16-15+ |
| InChIKey | RPRUUNVUUBHRNC-YOPQAMBCSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|