C18H29N — CID 155001648
(2E,4Z)-N-ethenyl-N-hexan-3-yl-3-methyl-6-methylideneocta-2,4,7-trien-2-amine (PubChem CID 155001648) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (2E,4Z)-N-ethenyl-N-hexan-3-yl-3-methyl-6-methylideneocta-2,4,7-trien-2-amine.
| Compound Name | (2E,4Z)-N-ethenyl-N-hexan-3-yl-3-methyl-6-methylideneocta-2,4,7-trien-2-amine |
|---|---|
| PubChem CID | 155001648 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (2E,4Z)-N-ethenyl-N-hexan-3-yl-3-methyl-6-methylideneocta-2,4,7-trien-2-amine |
| SMILES | C=CC(=C)/C=C\C(C)=C(/C)N(C=C)C(CC)CCC |
| InChI | InChI=1S/C18H29N/c1-8-12-18(10-3)19(11-4)17(7)16(6)14-13-15(5)9-2/h9,11,13-14,18H,2,4-5,8,10,12H2,1,3,6-7H3/b14-13-,17-16+ |
| InChIKey | ARDRZFSEPANJIU-XYRKOZFRSA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|