About di(hexan-3-yl)carbamic acid
di(hexan-3-yl)carbamic acid (PubChem CID 88787380) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is di(hexan-3-yl)carbamic acid.
Molecular Properties
| Compound Name | di(hexan-3-yl)carbamic acid |
| PubChem CID | 88787380 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | di(hexan-3-yl)carbamic acid |
| SMILES | CCCC(CC)N(C(=O)O)C(CC)CCC |
| InChI | InChI=1S/C13H27NO2/c1-5-9-11(7-3)14(13(15)16)12(8-4)10-6-2/h11-12H,5-10H2,1-4H3,(H,15,16) |
| InChIKey | TVOFNKHXPBBNNA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze di(hexan-3-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(hexan-3-yl)carbamic acid?
The IUPAC name of di(hexan-3-yl)carbamic acid (CID 88787380) is di(hexan-3-yl)carbamic acid.
What is the SMILES notation for di(hexan-3-yl)carbamic acid?
The canonical SMILES for di(hexan-3-yl)carbamic acid is CCCC(CC)N(C(=O)O)C(CC)CCC.
What is the InChIKey of di(hexan-3-yl)carbamic acid?
The InChIKey is TVOFNKHXPBBNNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-5-9-11(7-3)14(13(15)16)12(8-4)10-6-2/h11-12H,5-10H2,1-4H3,(H,15,16).
What are the key properties of di(hexan-3-yl)carbamic acid?
di(hexan-3-yl)carbamic acid has a molecular weight of 229.36 g/mol, XLogP of 4.12, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for di(hexan-3-yl)carbamic acid is sourced from PubChem (CID 88787380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).