C14H29N — CID 145230343
ethane;(2E,4Z)-2,3,6-trimethylhepta-2,4,6-trien-1-amine (PubChem CID 145230343) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is ethane;(2E,4Z)-2,3,6-trimethylhepta-2,4,6-trien-1-amine.
| Compound Name | ethane;(2E,4Z)-2,3,6-trimethylhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 145230343 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | ethane;(2E,4Z)-2,3,6-trimethylhepta-2,4,6-trien-1-amine |
| SMILES | C=C(C)/C=C\C(C)=C(/C)CN.CC.CC |
| InChI | InChI=1S/C10H17N.2C2H6/c1-8(2)5-6-9(3)10(4)7-11;2*1-2/h5-6H,1,7,11H2,2-4H3;2*1-2H3/b6-5-,10-9+;; |
| InChIKey | CDYDWEDHNDNPTR-GQJQLZFMSA-N |
| XLogP | 4.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|