C6H14N2 — CID 55291095
(E)-2,3-dimethylbut-2-ene-1,4-diamine (PubChem CID 55291095) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is (E)-2,3-dimethylbut-2-ene-1,4-diamine.
| Compound Name | (E)-2,3-dimethylbut-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 55291095 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (E)-2,3-dimethylbut-2-ene-1,4-diamine |
| SMILES | C/C(CN)=C(/C)CN |
| InChI | InChI=1S/C6H14N2/c1-5(3-7)6(2)4-8/h3-4,7-8H2,1-2H3/b6-5+ |
| InChIKey | RDPJLELODUFZHE-AATRIKPKSA-N |
| XLogP | 0.24 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|