About (E)-2-chlorobut-2-ene-1,3-diamine
(E)-2-chlorobut-2-ene-1,3-diamine (PubChem CID 146384599) has the molecular formula C4H9ClN2
and a molecular weight of 120.58 g/mol. Its IUPAC name is (E)-2-chlorobut-2-ene-1,3-diamine.
Molecular Properties
| Compound Name | (E)-2-chlorobut-2-ene-1,3-diamine |
| PubChem CID | 146384599 |
| Molecular Formula | C4H9ClN2 |
| Molecular Weight | 120.58 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | (E)-2-chlorobut-2-ene-1,3-diamine |
| SMILES | C/C(N)=C(\Cl)CN |
| InChI | InChI=1S/C4H9ClN2/c1-3(7)4(5)2-6/h2,6-7H2,1H3/b4-3+ |
| InChIKey | XCRUDQZZCLQRLS-ONEGZZNKSA-N |
| XLogP | 0.37 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.58 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-2-chlorobut-2-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-chlorobut-2-ene-1,3-diamine?
The IUPAC name of (E)-2-chlorobut-2-ene-1,3-diamine (CID 146384599) is (E)-2-chlorobut-2-ene-1,3-diamine.
What is the SMILES notation for (E)-2-chlorobut-2-ene-1,3-diamine?
The canonical SMILES for (E)-2-chlorobut-2-ene-1,3-diamine is C/C(N)=C(\Cl)CN.
What is the InChIKey of (E)-2-chlorobut-2-ene-1,3-diamine?
The InChIKey is XCRUDQZZCLQRLS-ONEGZZNKSA-N. The full InChI is InChI=1S/C4H9ClN2/c1-3(7)4(5)2-6/h2,6-7H2,1H3/b4-3+.
What are the key properties of (E)-2-chlorobut-2-ene-1,3-diamine?
(E)-2-chlorobut-2-ene-1,3-diamine has a molecular weight of 120.58 g/mol, XLogP of 0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-chlorobut-2-ene-1,3-diamine is sourced from PubChem (CID 146384599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).