About 2,3,3-trichloroprop-2-en-1-amine;hydrochloride
2,3,3-trichloroprop-2-en-1-amine;hydrochloride (PubChem CID 91643356) has the molecular formula C3H5Cl4N
and a molecular weight of 196.89 g/mol. Its IUPAC name is 2,3,3-trichloroprop-2-en-1-amine;hydrochloride.
Analyze 2,3,3-trichloroprop-2-en-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3-trichloroprop-2-en-1-amine;hydrochloride?
The IUPAC name of 2,3,3-trichloroprop-2-en-1-amine;hydrochloride (CID 91643356) is 2,3,3-trichloroprop-2-en-1-amine;hydrochloride.
What is the SMILES notation for 2,3,3-trichloroprop-2-en-1-amine;hydrochloride?
The canonical SMILES for 2,3,3-trichloroprop-2-en-1-amine;hydrochloride is Cl.NCC(Cl)=C(Cl)Cl.
What is the InChIKey of 2,3,3-trichloroprop-2-en-1-amine;hydrochloride?
The InChIKey is MRRKVKCQJVCBOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4Cl3N.ClH/c4-2(1-7)3(5)6;/h1,7H2;1H.
What are the key properties of 2,3,3-trichloroprop-2-en-1-amine;hydrochloride?
2,3,3-trichloroprop-2-en-1-amine;hydrochloride has a molecular weight of 196.89 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3-trichloroprop-2-en-1-amine;hydrochloride is sourced from PubChem (CID 91643356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).