C7H13Cl3N2 — CID 90856144
N'-(4,5,5-trichloropent-4-enyl)ethane-1,2-diamine (PubChem CID 90856144) has the molecular formula C7H13Cl3N2 and a molecular weight of 231.55 g/mol. Its IUPAC name is N'-(4,5,5-trichloropent-4-enyl)ethane-1,2-diamine.
| Compound Name | N'-(4,5,5-trichloropent-4-enyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 90856144 |
| Molecular Formula | C7H13Cl3N2 |
| Molecular Weight | 231.55 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | N'-(4,5,5-trichloropent-4-enyl)ethane-1,2-diamine |
| SMILES | NCCNCCCC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C7H13Cl3N2/c8-6(7(9)10)2-1-4-12-5-3-11/h12H,1-5,11H2 |
| InChIKey | AVYBVDPFXIPUDZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.55 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|