C11H22N2 — CID 142179621
(2E,4E)-2,5,6,6-tetramethylhepta-2,4-diene-1,3-diamine (PubChem CID 142179621) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (2E,4E)-2,5,6,6-tetramethylhepta-2,4-diene-1,3-diamine.
| Compound Name | (2E,4E)-2,5,6,6-tetramethylhepta-2,4-diene-1,3-diamine |
|---|---|
| PubChem CID | 142179621 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (2E,4E)-2,5,6,6-tetramethylhepta-2,4-diene-1,3-diamine |
| SMILES | C/C(=C\C(N)=C(\C)CN)C(C)(C)C |
| InChI | InChI=1S/C11H22N2/c1-8(7-12)10(13)6-9(2)11(3,4)5/h6H,7,12-13H2,1-5H3/b9-6+,10-8+ |
| InChIKey | PUOCXTCTGBMQGK-OAMUUVBCSA-N |
| XLogP | 2.17 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|