C7H14N2 — CID 163733302
(E,2E)-2-ethylidenepent-3-ene-1,4-diamine (PubChem CID 163733302) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (E,2E)-2-ethylidenepent-3-ene-1,4-diamine.
| Compound Name | (E,2E)-2-ethylidenepent-3-ene-1,4-diamine |
|---|---|
| PubChem CID | 163733302 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (E,2E)-2-ethylidenepent-3-ene-1,4-diamine |
| SMILES | C/C=C(\C=C(/C)N)CN |
| InChI | InChI=1S/C7H14N2/c1-3-7(5-8)4-6(2)9/h3-4H,5,8-9H2,1-2H3/b6-4+,7-3+ |
| InChIKey | LBMCOOHWECNYGP-DVFLZCIWSA-N |
| XLogP | 0.75 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|