C5H11N3 — CID 147865481
2-iminopent-3-ene-1,4-diamine (PubChem CID 147865481) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-iminopent-3-ene-1,4-diamine.
| Compound Name | 2-iminopent-3-ene-1,4-diamine |
|---|---|
| PubChem CID | 147865481 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 2-iminopent-3-ene-1,4-diamine |
| SMILES | [H]/N=C(/C=C(C)N)CN |
| InChI | InChI=1S/C5H11N3/c1-4(7)2-5(8)3-6/h2,8H,3,6-7H2,1H3/b4-2?,8-5- |
| InChIKey | VRQGZJYMEAVDEB-PADTVCEESA-N |
| XLogP | -0.17 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|