C7H14N2O2 — CID 57357519
4-imino-1,5-dimethoxypent-2-en-2-amine (PubChem CID 57357519) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is 4-imino-1,5-dimethoxypent-2-en-2-amine.
| Compound Name | 4-imino-1,5-dimethoxypent-2-en-2-amine |
|---|---|
| PubChem CID | 57357519 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 4-imino-1,5-dimethoxypent-2-en-2-amine |
| SMILES | [H]/N=C(/C=C(N)COC)COC |
| InChI | InChI=1S/C7H14N2O2/c1-10-4-6(8)3-7(9)5-11-2/h3,8H,4-5,9H2,1-2H3/b7-3?,8-6- |
| InChIKey | JZWBOKVWKPRGFJ-KGGFFWPWSA-N |
| XLogP | 0.14 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|