About 3-aminobut-2-enimidoyl fluoride
3-aminobut-2-enimidoyl fluoride (PubChem CID 149013787) has the molecular formula C4H7FN2
and a molecular weight of 102.11 g/mol. Its IUPAC name is 3-aminobut-2-enimidoyl fluoride.
Molecular Properties
| Compound Name | 3-aminobut-2-enimidoyl fluoride |
| PubChem CID | 149013787 |
| Molecular Formula | C4H7FN2 |
| Molecular Weight | 102.11 g/mol |
| Exact Mass | 102.06 |
| IUPAC Name | 3-aminobut-2-enimidoyl fluoride |
| SMILES | [H]/N=C(\F)C=C(C)N |
| InChI | InChI=1S/C4H7FN2/c1-3(6)2-4(5)7/h2,7H,6H2,1H3/b3-2?,7-4- |
| InChIKey | MWIRJPMVZCVIRO-JZABDGQBSA-N |
| XLogP | 0.80 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.11 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobut-2-enimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobut-2-enimidoyl fluoride?
The IUPAC name of 3-aminobut-2-enimidoyl fluoride (CID 149013787) is 3-aminobut-2-enimidoyl fluoride.
What is the SMILES notation for 3-aminobut-2-enimidoyl fluoride?
The canonical SMILES for 3-aminobut-2-enimidoyl fluoride is [H]/N=C(\F)C=C(C)N.
What is the InChIKey of 3-aminobut-2-enimidoyl fluoride?
The InChIKey is MWIRJPMVZCVIRO-JZABDGQBSA-N. The full InChI is InChI=1S/C4H7FN2/c1-3(6)2-4(5)7/h2,7H,6H2,1H3/b3-2?,7-4-.
What are the key properties of 3-aminobut-2-enimidoyl fluoride?
3-aminobut-2-enimidoyl fluoride has a molecular weight of 102.11 g/mol, XLogP of 0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobut-2-enimidoyl fluoride is sourced from PubChem (CID 149013787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).