About magnesium;ethanimidoyl fluoride;hydride
magnesium;ethanimidoyl fluoride;hydride (PubChem CID 174794498) has the molecular formula C2H6FMgN
and a molecular weight of 87.38 g/mol. Its IUPAC name is magnesium;ethanimidoyl fluoride;hydride.
Molecular Properties
| Compound Name | magnesium;ethanimidoyl fluoride;hydride |
| PubChem CID | 174794498 |
| Molecular Formula | C2H6FMgN |
| Molecular Weight | 87.38 g/mol |
| Exact Mass | 87.03 |
| IUPAC Name | magnesium;ethanimidoyl fluoride;hydride |
| SMILES | [H-].[H-].[H]/N=C(\C)F.[Mg+2] |
| InChI | InChI=1S/C2H4FN.Mg.2H/c1-2(3)4;;;/h4H,1H3;;;/q;+2;2*-1/b4-2+;;; |
| InChIKey | XAMVQARMKCDUPW-BSEPARLHSA-N |
| XLogP | 0.80 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium;ethanimidoyl fluoride;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;ethanimidoyl fluoride;hydride?
The IUPAC name of magnesium;ethanimidoyl fluoride;hydride (CID 174794498) is magnesium;ethanimidoyl fluoride;hydride.
What is the SMILES notation for magnesium;ethanimidoyl fluoride;hydride?
The canonical SMILES for magnesium;ethanimidoyl fluoride;hydride is [H-].[H-].[H]/N=C(\C)F.[Mg+2].
What is the InChIKey of magnesium;ethanimidoyl fluoride;hydride?
The InChIKey is XAMVQARMKCDUPW-BSEPARLHSA-N. The full InChI is InChI=1S/C2H4FN.Mg.2H/c1-2(3)4;;;/h4H,1H3;;;/q;+2;2*-1/b4-2+;;;.
What are the key properties of magnesium;ethanimidoyl fluoride;hydride?
magnesium;ethanimidoyl fluoride;hydride has a molecular weight of 87.38 g/mol, XLogP of 0.80, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;ethanimidoyl fluoride;hydride is sourced from PubChem (CID 174794498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).